C16H17ClF3N3O3S — CID 121294839
N-(3-chloro-4,5-difluorophenyl)-4-[(1-fluoro-2-methylpropan-2-yl)sulfamoyl]-1-methylpyrrole-2-carboxamide (PubChem CID 121294839) has the molecular formula C16H17ClF3N3O3S and a molecular weight of 423.84 g/mol. Its IUPAC name is N-(3-chloro-4,5-difluorophenyl)-4-[(1-fluoro-2-methylpropan-2-yl)sulfamoyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-(3-chloro-4,5-difluorophenyl)-4-[(1-fluoro-2-methylpropan-2-yl)sulfamoyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 121294839 |
| Molecular Formula | C16H17ClF3N3O3S |
| Molecular Weight | 423.84 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | N-(3-chloro-4,5-difluorophenyl)-4-[(1-fluoro-2-methylpropan-2-yl)sulfamoyl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(S(=O)(=O)NC(C)(C)CF)cc1C(=O)Nc1cc(F)c(F)c(Cl)c1 |
| InChI | InChI=1S/C16H17ClF3N3O3S/c1-16(2,8-18)22-27(25,26)10-6-13(23(3)7-10)15(24)21-9-4-11(17)14(20)12(19)5-9/h4-7,22H,8H2,1-3H3,(H,21,24) |
| InChIKey | OQRUFRODGVETAS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.84 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|