C17H16ClF2N3O4S — CID 158952621
4-[(1-carbamoylcyclopropyl)methylsulfonyl]-N-(3-chloro-4,5-difluorophenyl)-1-methylpyrrole-2-carboxamide (PubChem CID 158952621) has the molecular formula C17H16ClF2N3O4S and a molecular weight of 431.85 g/mol. Its IUPAC name is 4-[(1-carbamoylcyclopropyl)methylsulfonyl]-N-(3-chloro-4,5-difluorophenyl)-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-[(1-carbamoylcyclopropyl)methylsulfonyl]-N-(3-chloro-4,5-difluorophenyl)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 158952621 |
| Molecular Formula | C17H16ClF2N3O4S |
| Molecular Weight | 431.85 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 4-[(1-carbamoylcyclopropyl)methylsulfonyl]-N-(3-chloro-4,5-difluorophenyl)-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(S(=O)(=O)CC2(C(N)=O)CC2)cc1C(=O)Nc1cc(F)c(F)c(Cl)c1 |
| InChI | InChI=1S/C17H16ClF2N3O4S/c1-23-7-10(28(26,27)8-17(2-3-17)16(21)25)6-13(23)15(24)22-9-4-11(18)14(20)12(19)5-9/h4-7H,2-3,8H2,1H3,(H2,21,25)(H,22,24) |
| InChIKey | JLPVGXGYGFMVMK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.85 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|