C20H20ClF2N3O3 — CID 126493638
4-[1-(tert-butylcarbamoyl)-2-oxocyclopropyl]-N-(3-chloro-4,5-difluorophenyl)-1-methylpyrrole-2-carboxamide (PubChem CID 126493638) has the molecular formula C20H20ClF2N3O3 and a molecular weight of 423.85 g/mol. Its IUPAC name is 4-[1-(tert-butylcarbamoyl)-2-oxocyclopropyl]-N-(3-chloro-4,5-difluorophenyl)-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-[1-(tert-butylcarbamoyl)-2-oxocyclopropyl]-N-(3-chloro-4,5-difluorophenyl)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 126493638 |
| Molecular Formula | C20H20ClF2N3O3 |
| Molecular Weight | 423.85 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 4-[1-(tert-butylcarbamoyl)-2-oxocyclopropyl]-N-(3-chloro-4,5-difluorophenyl)-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(C2(C(=O)NC(C)(C)C)CC2=O)cc1C(=O)Nc1cc(F)c(F)c(Cl)c1 |
| InChI | InChI=1S/C20H20ClF2N3O3/c1-19(2,3)25-18(29)20(8-15(20)27)10-5-14(26(4)9-10)17(28)24-11-6-12(21)16(23)13(22)7-11/h5-7,9H,8H2,1-4H3,(H,24,28)(H,25,29) |
| InChIKey | KOWIUSHLRNGQQS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.85 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|