C16H17BrF2N2O3S — CID 152808936
N-(3-bromo-4,5-difluorophenyl)-1-methyl-4-(2-methylpropylsulfonyl)pyrrole-2-carboxamide (PubChem CID 152808936) has the molecular formula C16H17BrF2N2O3S and a molecular weight of 435.29 g/mol. Its IUPAC name is N-(3-bromo-4,5-difluorophenyl)-1-methyl-4-(2-methylpropylsulfonyl)pyrrole-2-carboxamide.
| Compound Name | N-(3-bromo-4,5-difluorophenyl)-1-methyl-4-(2-methylpropylsulfonyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 152808936 |
| Molecular Formula | C16H17BrF2N2O3S |
| Molecular Weight | 435.29 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | N-(3-bromo-4,5-difluorophenyl)-1-methyl-4-(2-methylpropylsulfonyl)pyrrole-2-carboxamide |
| SMILES | CC(C)CS(=O)(=O)c1cc(C(=O)Nc2cc(F)c(F)c(Br)c2)n(C)c1 |
| InChI | InChI=1S/C16H17BrF2N2O3S/c1-9(2)8-25(23,24)11-6-14(21(3)7-11)16(22)20-10-4-12(17)15(19)13(18)5-10/h4-7,9H,8H2,1-3H3,(H,20,22) |
| InChIKey | SQDOIQDFKGGVDS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|