C16H19ClF3N3O3S2 — CID 159827438
N-(2-chloro-4-pyridinyl)-1-methyl-4-[(2S)-2-(trifluoromethyl)butyl]sulfonylpyrrole-2-carboxamide;sulfane (PubChem CID 159827438) has the molecular formula C16H19ClF3N3O3S2 and a molecular weight of 457.93 g/mol. Its IUPAC name is N-(2-chloro-4-pyridinyl)-1-methyl-4-[(2S)-2-(trifluoromethyl)butyl]sulfonylpyrrole-2-carboxamide;sulfane.
| Compound Name | N-(2-chloro-4-pyridinyl)-1-methyl-4-[(2S)-2-(trifluoromethyl)butyl]sulfonylpyrrole-2-carboxamide;sulfane |
|---|---|
| PubChem CID | 159827438 |
| Molecular Formula | C16H19ClF3N3O3S2 |
| Molecular Weight | 457.93 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | N-(2-chloro-4-pyridinyl)-1-methyl-4-[(2S)-2-(trifluoromethyl)butyl]sulfonylpyrrole-2-carboxamide;sulfane |
| SMILES | CC[C@H](CS(=O)(=O)c1cc(C(=O)Nc2ccnc(Cl)c2)n(C)c1)C(F)(F)F.S |
| InChI | InChI=1S/C16H17ClF3N3O3S.H2S/c1-3-10(16(18,19)20)9-27(25,26)12-7-13(23(2)8-12)15(24)22-11-4-5-21-14(17)6-11;/h4-8,10H,3,9H2,1-2H3,(H,21,22,24);1H2/t10-;/m1./s1 |
| InChIKey | NNAFVEGQPVPMKV-HNCPQSOCSA-N |
| XLogP | 3.80 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.93 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|