C16H13ClF5N3O2S — CID 126493608
N-(3-chloro-4,5-difluorophenyl)-1-methyl-4-[1-(trifluoromethyl)cyclopropyl]sulfinamoylpyrrole-2-carboxamide (PubChem CID 126493608) has the molecular formula C16H13ClF5N3O2S and a molecular weight of 441.81 g/mol. Its IUPAC name is N-(3-chloro-4,5-difluorophenyl)-1-methyl-4-[1-(trifluoromethyl)cyclopropyl]sulfinamoylpyrrole-2-carboxamide.
| Compound Name | N-(3-chloro-4,5-difluorophenyl)-1-methyl-4-[1-(trifluoromethyl)cyclopropyl]sulfinamoylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 126493608 |
| Molecular Formula | C16H13ClF5N3O2S |
| Molecular Weight | 441.81 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | N-(3-chloro-4,5-difluorophenyl)-1-methyl-4-[1-(trifluoromethyl)cyclopropyl]sulfinamoylpyrrole-2-carboxamide |
| SMILES | Cn1cc(S(=O)NC2(C(F)(F)F)CC2)cc1C(=O)Nc1cc(F)c(F)c(Cl)c1 |
| InChI | InChI=1S/C16H13ClF5N3O2S/c1-25-7-9(28(27)24-15(2-3-15)16(20,21)22)6-12(25)14(26)23-8-4-10(17)13(19)11(18)5-8/h4-7,24H,2-3H2,1H3,(H,23,26) |
| InChIKey | MAXBDJPRWYDISO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.81 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|