C16H18ClF3N4OS — CID 142392399
4-[(tert-butylamino)sulfanylamino]-3-chloro-1-methyl-N-(3,4,5-trifluorophenyl)pyrrole-2-carboxamide (PubChem CID 142392399) has the molecular formula C16H18ClF3N4OS and a molecular weight of 406.86 g/mol. Its IUPAC name is 4-[(tert-butylamino)sulfanylamino]-3-chloro-1-methyl-N-(3,4,5-trifluorophenyl)pyrrole-2-carboxamide.
| Compound Name | 4-[(tert-butylamino)sulfanylamino]-3-chloro-1-methyl-N-(3,4,5-trifluorophenyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 142392399 |
| Molecular Formula | C16H18ClF3N4OS |
| Molecular Weight | 406.86 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 4-[(tert-butylamino)sulfanylamino]-3-chloro-1-methyl-N-(3,4,5-trifluorophenyl)pyrrole-2-carboxamide |
| SMILES | Cn1cc(NSNC(C)(C)C)c(Cl)c1C(=O)Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C16H18ClF3N4OS/c1-16(2,3)23-26-22-11-7-24(4)14(12(11)17)15(25)21-8-5-9(18)13(20)10(19)6-8/h5-7,22-23H,1-4H3,(H,21,25) |
| InChIKey | QNKAOHABLQLZBF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 58.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.86 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|