C15H14F3N3O3S2 — CID 139471007
4-[(Z)-3-amino-3-sulfanylprop-1-enyl]-1-methyl-5-[(3,4,5-trifluorophenyl)carbamoyl]pyrrole-3-sulfinic acid (PubChem CID 139471007) has the molecular formula C15H14F3N3O3S2 and a molecular weight of 405.42 g/mol. Its IUPAC name is 4-[(Z)-3-amino-3-sulfanylprop-1-enyl]-1-methyl-5-[(3,4,5-trifluorophenyl)carbamoyl]pyrrole-3-sulfinic acid.
| Compound Name | 4-[(Z)-3-amino-3-sulfanylprop-1-enyl]-1-methyl-5-[(3,4,5-trifluorophenyl)carbamoyl]pyrrole-3-sulfinic acid |
|---|---|
| PubChem CID | 139471007 |
| Molecular Formula | C15H14F3N3O3S2 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | 4-[(Z)-3-amino-3-sulfanylprop-1-enyl]-1-methyl-5-[(3,4,5-trifluorophenyl)carbamoyl]pyrrole-3-sulfinic acid |
| SMILES | Cn1cc(S(=O)O)c(/C=C\C(N)S)c1C(=O)Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C15H14F3N3O3S2/c1-21-6-11(26(23)24)8(2-3-12(19)25)14(21)15(22)20-7-4-9(16)13(18)10(17)5-7/h2-6,12,25H,19H2,1H3,(H,20,22)(H,23,24)/b3-2- |
| InChIKey | YGEPORMHHDCNBI-IHWYPQMZSA-N |
| XLogP | 2.50 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|