C17H19F4N5O4S2 — CID 156647666
3-fluoro-1-methyl-4-[1-(methylsulfamoyl)pyrrolidin-3-yl]sulfinamoyl-N-(3,4,5-trifluorophenyl)pyrrole-2-carboxamide (PubChem CID 156647666) has the molecular formula C17H19F4N5O4S2 and a molecular weight of 497.50 g/mol. Its IUPAC name is 3-fluoro-1-methyl-4-[1-(methylsulfamoyl)pyrrolidin-3-yl]sulfinamoyl-N-(3,4,5-trifluorophenyl)pyrrole-2-carboxamide.
| Compound Name | 3-fluoro-1-methyl-4-[1-(methylsulfamoyl)pyrrolidin-3-yl]sulfinamoyl-N-(3,4,5-trifluorophenyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 156647666 |
| Molecular Formula | C17H19F4N5O4S2 |
| Molecular Weight | 497.50 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | 3-fluoro-1-methyl-4-[1-(methylsulfamoyl)pyrrolidin-3-yl]sulfinamoyl-N-(3,4,5-trifluorophenyl)pyrrole-2-carboxamide |
| SMILES | CNS(=O)(=O)N1CCC(NS(=O)c2cn(C)c(C(=O)Nc3cc(F)c(F)c(F)c3)c2F)C1 |
| InChI | InChI=1S/C17H19F4N5O4S2/c1-22-32(29,30)26-4-3-9(7-26)24-31(28)13-8-25(2)16(15(13)21)17(27)23-10-5-11(18)14(20)12(19)6-10/h5-6,8-9,22,24H,3-4,7H2,1-2H3,(H,23,27) |
| InChIKey | QCIAWZUBBZOCHL-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 112.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.50 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|