C16H19F3N5O4+ — CID 175101641
1,1-dihydroxy-3-[(1S)-1-hydroxyethyl]-7-methyl-N-(3,4,5-trifluorophenyl)-4,5-dihydro-2H-pyrrolo[3,4-d]triazepin-1-ium-6-carboxamide (PubChem CID 175101641) has the molecular formula C16H19F3N5O4+ and a molecular weight of 402.35 g/mol. Its IUPAC name is 1,1-dihydroxy-3-[(1S)-1-hydroxyethyl]-7-methyl-N-(3,4,5-trifluorophenyl)-4,5-dihydro-2H-pyrrolo[3,4-d]triazepin-1-ium-6-carboxamide.
| Compound Name | 1,1-dihydroxy-3-[(1S)-1-hydroxyethyl]-7-methyl-N-(3,4,5-trifluorophenyl)-4,5-dihydro-2H-pyrrolo[3,4-d]triazepin-1-ium-6-carboxamide |
|---|---|
| PubChem CID | 175101641 |
| Molecular Formula | C16H19F3N5O4+ |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 1,1-dihydroxy-3-[(1S)-1-hydroxyethyl]-7-methyl-N-(3,4,5-trifluorophenyl)-4,5-dihydro-2H-pyrrolo[3,4-d]triazepin-1-ium-6-carboxamide |
| SMILES | C[C@H](O)N1CCc2c(cn(C)c2C(=O)Nc2cc(F)c(F)c(F)c2)[N+](O)(O)N1 |
| InChI | InChI=1S/C16H18F3N5O4/c1-8(25)23-4-3-10-13(24(27,28)21-23)7-22(2)15(10)16(26)20-9-5-11(17)14(19)12(18)6-9/h5-8,21,25,27-28H,3-4H2,1-2H3/p+1/t8-/m0/s1 |
| InChIKey | BLWJOPLJSAZASP-QMMMGPOBSA-O |
| XLogP | 1.40 |
| TPSA | 109.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|