C17H18Cl2F2N2O3S — CID 158870079
3-chloro-N-(3-chloro-2,4-difluorophenyl)-4-(2,2-dimethylpropylsulfonyl)-1-methylpyrrole-2-carboxamide (PubChem CID 158870079) has the molecular formula C17H18Cl2F2N2O3S and a molecular weight of 439.31 g/mol. Its IUPAC name is 3-chloro-N-(3-chloro-2,4-difluorophenyl)-4-(2,2-dimethylpropylsulfonyl)-1-methylpyrrole-2-carboxamide.
| Compound Name | 3-chloro-N-(3-chloro-2,4-difluorophenyl)-4-(2,2-dimethylpropylsulfonyl)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 158870079 |
| Molecular Formula | C17H18Cl2F2N2O3S |
| Molecular Weight | 439.31 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | 3-chloro-N-(3-chloro-2,4-difluorophenyl)-4-(2,2-dimethylpropylsulfonyl)-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(S(=O)(=O)CC(C)(C)C)c(Cl)c1C(=O)Nc1ccc(F)c(Cl)c1F |
| InChI | InChI=1S/C17H18Cl2F2N2O3S/c1-17(2,3)8-27(25,26)11-7-23(4)15(13(11)19)16(24)22-10-6-5-9(20)12(18)14(10)21/h5-7H,8H2,1-4H3,(H,22,24) |
| InChIKey | JBSSSAGOFIRIFI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.31 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|