C11H9Cl2FN4O3S — CID 166687312
3-chloro-N-(6-chloro-5-fluoro-2-pyridinyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide (PubChem CID 166687312) has the molecular formula C11H9Cl2FN4O3S and a molecular weight of 367.19 g/mol. Its IUPAC name is 3-chloro-N-(6-chloro-5-fluoro-2-pyridinyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide.
| Compound Name | 3-chloro-N-(6-chloro-5-fluoro-2-pyridinyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 166687312 |
| Molecular Formula | C11H9Cl2FN4O3S |
| Molecular Weight | 367.19 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | 3-chloro-N-(6-chloro-5-fluoro-2-pyridinyl)-1-methyl-4-sulfamoylpyrrole-2-carboxamide |
| SMILES | Cn1cc(S(N)(=O)=O)c(Cl)c1C(=O)Nc1ccc(F)c(Cl)n1 |
| InChI | InChI=1S/C11H9Cl2FN4O3S/c1-18-4-6(22(15,20)21)8(12)9(18)11(19)17-7-3-2-5(14)10(13)16-7/h2-4H,1H3,(H2,15,20,21)(H,16,17,19) |
| InChIKey | SCGLWYVROBSRNE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.19 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|