C27H25Cl2F3N2O7S2 — CID 121297623
[tert-butyl-[4-[[4-chloro-2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]phenyl]sulfonylmethyl]benzoyl]amino] acetate (PubChem CID 121297623) has the molecular formula C27H25Cl2F3N2O7S2 and a molecular weight of 681.54 g/mol. Its IUPAC name is [tert-butyl-[4-[[4-chloro-2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]phenyl]sulfonylmethyl]benzoyl]amino] acetate.
| Compound Name | [tert-butyl-[4-[[4-chloro-2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]phenyl]sulfonylmethyl]benzoyl]amino] acetate |
|---|---|
| PubChem CID | 121297623 |
| Molecular Formula | C27H25Cl2F3N2O7S2 |
| Molecular Weight | 681.54 g/mol |
| Exact Mass | 680.04 |
| IUPAC Name | [tert-butyl-[4-[[4-chloro-2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]phenyl]sulfonylmethyl]benzoyl]amino] acetate |
| SMILES | CC(=O)ON(C(=O)c1ccc(CS(=O)(=O)c2ccc(Cl)cc2NS(=O)(=O)c2ccc(Cl)c(C(F)(F)F)c2)cc1)C(C)(C)C |
| InChI | InChI=1S/C27H25Cl2F3N2O7S2/c1-16(35)41-34(26(2,3)4)25(36)18-7-5-17(6-8-18)15-42(37,38)24-12-9-19(28)13-23(24)33-43(39,40)20-10-11-22(29)21(14-20)27(30,31)32/h5-14,33H,15H2,1-4H3 |
| InChIKey | ZKCBCGYEUGQEPD-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.54 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|