C13H11F3N3O2S+ — CID 121300140
2,2,2-trifluoro-1-[5-(1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-carbonyl)thiophen-2-yl]ethanone (PubChem CID 121300140) has the molecular formula C13H11F3N3O2S+ and a molecular weight of 330.31 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[5-(1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-carbonyl)thiophen-2-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[5-(1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-carbonyl)thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 121300140 |
| Molecular Formula | C13H11F3N3O2S+ |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 2,2,2-trifluoro-1-[5-(1,5,6,8-tetrahydroimidazo[1,2-a]pyrazin-4-ium-7-carbonyl)thiophen-2-yl]ethanone |
| SMILES | O=C(c1ccc(C(=O)C(F)(F)F)s1)N1CC[n+]2cc[nH]c2C1 |
| InChI | InChI=1S/C13H10F3N3O2S/c14-13(15,16)11(20)8-1-2-9(22-8)12(21)19-6-5-18-4-3-17-10(18)7-19/h1-4H,5-7H2/p+1 |
| InChIKey | PDJCVAVILOVRBX-UHFFFAOYSA-O |
| XLogP | 1.76 |
| TPSA | 57.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|