C19H19F3N2O2S — CID 69184024
2,2,2-trifluoro-1-[5-[3-methyl-4-(4-methylphenyl)piperazine-1-carbonyl]thiophen-2-yl]ethanone (PubChem CID 69184024) has the molecular formula C19H19F3N2O2S and a molecular weight of 396.43 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[5-[3-methyl-4-(4-methylphenyl)piperazine-1-carbonyl]thiophen-2-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[5-[3-methyl-4-(4-methylphenyl)piperazine-1-carbonyl]thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 69184024 |
| Molecular Formula | C19H19F3N2O2S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 2,2,2-trifluoro-1-[5-[3-methyl-4-(4-methylphenyl)piperazine-1-carbonyl]thiophen-2-yl]ethanone |
| SMILES | Cc1ccc(N2CCN(C(=O)c3ccc(C(=O)C(F)(F)F)s3)CC2C)cc1 |
| InChI | InChI=1S/C19H19F3N2O2S/c1-12-3-5-14(6-4-12)24-10-9-23(11-13(24)2)18(26)16-8-7-15(27-16)17(25)19(20,21)22/h3-8,13H,9-11H2,1-2H3 |
| InChIKey | YBMKRYAUDQVZJH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|