C17H21ClN4O — CID 17126686
(4-chloro-1-methylpyrazol-5-yl)-[3-methyl-4-(4-methylphenyl)piperazin-1-yl]methanone (PubChem CID 17126686) has the molecular formula C17H21ClN4O and a molecular weight of 332.84 g/mol. Its IUPAC name is (4-chloro-1-methylpyrazol-5-yl)-[3-methyl-4-(4-methylphenyl)piperazin-1-yl]methanone.
| Compound Name | (4-chloro-1-methylpyrazol-5-yl)-[3-methyl-4-(4-methylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 17126686 |
| Molecular Formula | C17H21ClN4O |
| Molecular Weight | 332.84 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (4-chloro-1-methylpyrazol-5-yl)-[3-methyl-4-(4-methylphenyl)piperazin-1-yl]methanone |
| SMILES | Cc1ccc(N2CCN(C(=O)c3c(Cl)cnn3C)CC2C)cc1 |
| InChI | InChI=1S/C17H21ClN4O/c1-12-4-6-14(7-5-12)22-9-8-21(11-13(22)2)17(23)16-15(18)10-19-20(16)3/h4-7,10,13H,8-9,11H2,1-3H3 |
| InChIKey | XVLRYFOFPYOAIP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.84 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|