C22H30N2O3 — CID 124764441
(2R,3R)-3-[(3S)-3-methyl-4-(4-methylphenyl)piperazine-1-carbonyl]bicyclo[2.2.2]octane-2-carboxylic acid (PubChem CID 124764441) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is (2R,3R)-3-[(3S)-3-methyl-4-(4-methylphenyl)piperazine-1-carbonyl]bicyclo[2.2.2]octane-2-carboxylic acid.
| Compound Name | (2R,3R)-3-[(3S)-3-methyl-4-(4-methylphenyl)piperazine-1-carbonyl]bicyclo[2.2.2]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 124764441 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | (2R,3R)-3-[(3S)-3-methyl-4-(4-methylphenyl)piperazine-1-carbonyl]bicyclo[2.2.2]octane-2-carboxylic acid |
| SMILES | Cc1ccc(N2CCN(C(=O)[C@@H]3C4CCC(CC4)[C@H]3C(=O)O)C[C@@H]2C)cc1 |
| InChI | InChI=1S/C22H30N2O3/c1-14-3-9-18(10-4-14)24-12-11-23(13-15(24)2)21(25)19-16-5-7-17(8-6-16)20(19)22(26)27/h3-4,9-10,15-17,19-20H,5-8,11-13H2,1-2H3,(H,26,27)/t15-,16?,17?,19+,20+/m0/s1 |
| InChIKey | ZFJYZWLKSVMHGO-GAIHSPJBSA-N |
| XLogP | 3.17 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|