C24H23N3O2S — CID 20855958
2-[3-methyl-4-(4-methylphenyl)piperazine-1-carbonyl]-5H-thieno[3,2-c]quinolin-4-one (PubChem CID 20855958) has the molecular formula C24H23N3O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is 2-[3-methyl-4-(4-methylphenyl)piperazine-1-carbonyl]-5H-thieno[3,2-c]quinolin-4-one.
| Compound Name | 2-[3-methyl-4-(4-methylphenyl)piperazine-1-carbonyl]-5H-thieno[3,2-c]quinolin-4-one |
|---|---|
| PubChem CID | 20855958 |
| Molecular Formula | C24H23N3O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 2-[3-methyl-4-(4-methylphenyl)piperazine-1-carbonyl]-5H-thieno[3,2-c]quinolin-4-one |
| SMILES | Cc1ccc(N2CCN(C(=O)c3cc4c(=O)[nH]c5ccccc5c4s3)CC2C)cc1 |
| InChI | InChI=1S/C24H23N3O2S/c1-15-7-9-17(10-8-15)27-12-11-26(14-16(27)2)24(29)21-13-19-22(30-21)18-5-3-4-6-20(18)25-23(19)28/h3-10,13,16H,11-12,14H2,1-2H3,(H,25,28) |
| InChIKey | LMKDQIPNGQSQQN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|