C28H26F5NO6 — CID 121301020
3-[(2R,4R)-4-[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-7-(trifluoromethyl)-3,4-dihydro-2H-chromen-2-yl]cyclohexane-1-carboxylic acid (PubChem CID 121301020) has the molecular formula C28H26F5NO6 and a molecular weight of 567.51 g/mol. Its IUPAC name is 3-[(2R,4R)-4-[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-7-(trifluoromethyl)-3,4-dihydro-2H-chromen-2-yl]cyclohexane-1-carboxylic acid.
| Compound Name | 3-[(2R,4R)-4-[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-7-(trifluoromethyl)-3,4-dihydro-2H-chromen-2-yl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 121301020 |
| Molecular Formula | C28H26F5NO6 |
| Molecular Weight | 567.51 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | 3-[(2R,4R)-4-[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-7-(trifluoromethyl)-3,4-dihydro-2H-chromen-2-yl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCC([C@H]2C[C@@H](NC(=O)C3(c4ccc5c(c4)OC(F)(F)O5)CC3)c3ccc(C(F)(F)F)cc3O2)C1 |
| InChI | InChI=1S/C28H26F5NO6/c29-27(30,31)17-4-6-18-19(13-21(38-22(18)12-17)14-2-1-3-15(10-14)24(35)36)34-25(37)26(8-9-26)16-5-7-20-23(11-16)40-28(32,33)39-20/h4-7,11-12,14-15,19,21H,1-3,8-10,13H2,(H,34,37)(H,35,36)/t14?,15?,19-,21-/m1/s1 |
| InChIKey | MVTOWPCDANAKLO-ITYSUYTRSA-N |
| XLogP | 5.96 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.51 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |