C25H26F2N2O8 — CID 121301145
(2R,4S)-4-[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-N-(1,3-dihydroxypropan-2-yl)-7-methoxy-3,4-dihydro-2H-chromene-2-carboxamide (PubChem CID 121301145) has the molecular formula C25H26F2N2O8 and a molecular weight of 520.49 g/mol. Its IUPAC name is (2R,4S)-4-[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-N-(1,3-dihydroxypropan-2-yl)-7-methoxy-3,4-dihydro-2H-chromene-2-carboxamide.
| Compound Name | (2R,4S)-4-[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-N-(1,3-dihydroxypropan-2-yl)-7-methoxy-3,4-dihydro-2H-chromene-2-carboxamide |
|---|---|
| PubChem CID | 121301145 |
| Molecular Formula | C25H26F2N2O8 |
| Molecular Weight | 520.49 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | (2R,4S)-4-[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-N-(1,3-dihydroxypropan-2-yl)-7-methoxy-3,4-dihydro-2H-chromene-2-carboxamide |
| SMILES | COc1ccc2c(c1)O[C@@H](C(=O)NC(CO)CO)C[C@@H]2NC(=O)C1(c2ccc3c(c2)OC(F)(F)O3)CC1 |
| InChI | InChI=1S/C25H26F2N2O8/c1-34-15-3-4-16-17(10-21(35-19(16)9-15)22(32)28-14(11-30)12-31)29-23(33)24(6-7-24)13-2-5-18-20(8-13)37-25(26,27)36-18/h2-5,8-9,14,17,21,30-31H,6-7,10-12H2,1H3,(H,28,32)(H,29,33)/t17-,21+/m0/s1 |
| InChIKey | GJMIGFMXSNUGBH-LAUBAEHRSA-N |
| XLogP | 1.53 |
| TPSA | 135.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.49 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |