C27H30F2N2O8S — CID 121301491
(2R,4R)-4-[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-N-(1,1-dihydroxythian-4-yl)-7-methoxy-3,4-dihydro-2H-chromene-2-carboxamide (PubChem CID 121301491) has the molecular formula C27H30F2N2O8S and a molecular weight of 580.61 g/mol. Its IUPAC name is (2R,4R)-4-[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-N-(1,1-dihydroxythian-4-yl)-7-methoxy-3,4-dihydro-2H-chromene-2-carboxamide.
| Compound Name | (2R,4R)-4-[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-N-(1,1-dihydroxythian-4-yl)-7-methoxy-3,4-dihydro-2H-chromene-2-carboxamide |
|---|---|
| PubChem CID | 121301491 |
| Molecular Formula | C27H30F2N2O8S |
| Molecular Weight | 580.61 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | (2R,4R)-4-[[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]-N-(1,1-dihydroxythian-4-yl)-7-methoxy-3,4-dihydro-2H-chromene-2-carboxamide |
| SMILES | COc1ccc2c(c1)O[C@@H](C(=O)NC1CCS(O)(O)CC1)C[C@H]2NC(=O)C1(c2ccc3c(c2)OC(F)(F)O3)CC1 |
| InChI | InChI=1S/C27H30F2N2O8S/c1-36-17-3-4-18-19(14-23(37-21(18)13-17)24(32)30-16-6-10-40(34,35)11-7-16)31-25(33)26(8-9-26)15-2-5-20-22(12-15)39-27(28,29)38-20/h2-5,12-13,16,19,23,34-35H,6-11,14H2,1H3,(H,30,32)(H,31,33)/t19-,23-/m1/s1 |
| InChIKey | QQFFNFCRIAIRHJ-AUSIDOKSSA-N |
| XLogP | 4.09 |
| TPSA | 135.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.61 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |