C30H27F2NO7 — CID 140766861
methyl 4-[(2R,4R)-4-[(2,2-difluoro-7-methyl-5,6-dihydrocyclopenta[f][1,3]benzodioxole-7-carbonyl)amino]-7-methoxy-3,4-dihydro-2H-chromen-2-yl]benzoate (PubChem CID 140766861) has the molecular formula C30H27F2NO7 and a molecular weight of 551.54 g/mol. Its IUPAC name is methyl 4-[(2R,4R)-4-[(2,2-difluoro-7-methyl-5,6-dihydrocyclopenta[f][1,3]benzodioxole-7-carbonyl)amino]-7-methoxy-3,4-dihydro-2H-chromen-2-yl]benzoate.
| Compound Name | methyl 4-[(2R,4R)-4-[(2,2-difluoro-7-methyl-5,6-dihydrocyclopenta[f][1,3]benzodioxole-7-carbonyl)amino]-7-methoxy-3,4-dihydro-2H-chromen-2-yl]benzoate |
|---|---|
| PubChem CID | 140766861 |
| Molecular Formula | C30H27F2NO7 |
| Molecular Weight | 551.54 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | methyl 4-[(2R,4R)-4-[(2,2-difluoro-7-methyl-5,6-dihydrocyclopenta[f][1,3]benzodioxole-7-carbonyl)amino]-7-methoxy-3,4-dihydro-2H-chromen-2-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2C[C@@H](NC(=O)C3(C)CCc4cc5c(cc43)OC(F)(F)O5)c3ccc(OC)cc3O2)cc1 |
| InChI | InChI=1S/C30H27F2NO7/c1-29(11-10-18-12-25-26(14-21(18)29)40-30(31,32)39-25)28(35)33-22-15-23(16-4-6-17(7-5-16)27(34)37-3)38-24-13-19(36-2)8-9-20(22)24/h4-9,12-14,22-23H,10-11,15H2,1-3H3,(H,33,35)/t22-,23-,29?/m1/s1 |
| InChIKey | OGFCKWVYUUMUPX-JEVJGCHESA-N |
| XLogP | 5.39 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.54 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |