C25H21F2N3O7 — CID 140766986
(7R)-2,2-difluoro-N-[(2S,4R)-7-methoxy-2-(6-oxo-1H-pyridazin-3-yl)-3,4-dihydro-2H-chromen-4-yl]-7-methyl-6H-furo[2,3-f][1,3]benzodioxole-7-carboxamide (PubChem CID 140766986) has the molecular formula C25H21F2N3O7 and a molecular weight of 513.45 g/mol. Its IUPAC name is (7R)-2,2-difluoro-N-[(2S,4R)-7-methoxy-2-(6-oxo-1H-pyridazin-3-yl)-3,4-dihydro-2H-chromen-4-yl]-7-methyl-6H-furo[2,3-f][1,3]benzodioxole-7-carboxamide.
| Compound Name | (7R)-2,2-difluoro-N-[(2S,4R)-7-methoxy-2-(6-oxo-1H-pyridazin-3-yl)-3,4-dihydro-2H-chromen-4-yl]-7-methyl-6H-furo[2,3-f][1,3]benzodioxole-7-carboxamide |
|---|---|
| PubChem CID | 140766986 |
| Molecular Formula | C25H21F2N3O7 |
| Molecular Weight | 513.45 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | (7R)-2,2-difluoro-N-[(2S,4R)-7-methoxy-2-(6-oxo-1H-pyridazin-3-yl)-3,4-dihydro-2H-chromen-4-yl]-7-methyl-6H-furo[2,3-f][1,3]benzodioxole-7-carboxamide |
| SMILES | COc1ccc2c(c1)O[C@H](c1ccc(=O)[nH]n1)C[C@H]2NC(=O)[C@@]1(C)COc2cc3c(cc21)OC(F)(F)O3 |
| InChI | InChI=1S/C25H21F2N3O7/c1-24(11-34-18-10-21-20(8-14(18)24)36-25(26,27)37-21)23(32)28-16-9-19(15-5-6-22(31)30-29-15)35-17-7-12(33-2)3-4-13(16)17/h3-8,10,16,19H,9,11H2,1-2H3,(H,28,32)(H,30,31)/t16-,19+,24+/m1/s1 |
| InChIKey | VOPKOFYQIQOVID-MTJJIEKYSA-N |
| XLogP | 3.13 |
| TPSA | 121.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |