C29H25F2NO8 — CID 140767144
methyl 4-[(2R,4R)-4-[(2,2-difluoro-7-methyl-6H-furo[2,3-f][1,3]benzodioxole-7-carbonyl)amino]-7-methoxy-3,4-dihydro-2H-chromen-2-yl]benzoate (PubChem CID 140767144) has the molecular formula C29H25F2NO8 and a molecular weight of 553.51 g/mol. Its IUPAC name is methyl 4-[(2R,4R)-4-[(2,2-difluoro-7-methyl-6H-furo[2,3-f][1,3]benzodioxole-7-carbonyl)amino]-7-methoxy-3,4-dihydro-2H-chromen-2-yl]benzoate.
| Compound Name | methyl 4-[(2R,4R)-4-[(2,2-difluoro-7-methyl-6H-furo[2,3-f][1,3]benzodioxole-7-carbonyl)amino]-7-methoxy-3,4-dihydro-2H-chromen-2-yl]benzoate |
|---|---|
| PubChem CID | 140767144 |
| Molecular Formula | C29H25F2NO8 |
| Molecular Weight | 553.51 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | methyl 4-[(2R,4R)-4-[(2,2-difluoro-7-methyl-6H-furo[2,3-f][1,3]benzodioxole-7-carbonyl)amino]-7-methoxy-3,4-dihydro-2H-chromen-2-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2C[C@@H](NC(=O)C3(C)COc4cc5c(cc43)OC(F)(F)O5)c3ccc(OC)cc3O2)cc1 |
| InChI | InChI=1S/C29H25F2NO8/c1-28(14-37-23-13-25-24(11-19(23)28)39-29(30,31)40-25)27(34)32-20-12-21(15-4-6-16(7-5-15)26(33)36-3)38-22-10-17(35-2)8-9-18(20)22/h4-11,13,20-21H,12,14H2,1-3H3,(H,32,34)/t20-,21-,28?/m1/s1 |
| InChIKey | PQHRKYFWWNRTMN-HGQPVNBUSA-N |
| XLogP | 4.83 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |