C28H23F2NO8 — CID 138596857
4-[(2R,4R)-4-[[(7S)-2,2-difluoro-7-methyl-6H-furo[2,3-f][1,3]benzodioxole-7-carbonyl]amino]-7-methoxy-3,4-dihydro-2H-chromen-2-yl]benzoic acid (PubChem CID 138596857) has the molecular formula C28H23F2NO8 and a molecular weight of 539.49 g/mol. Its IUPAC name is 4-[(2R,4R)-4-[[(7S)-2,2-difluoro-7-methyl-6H-furo[2,3-f][1,3]benzodioxole-7-carbonyl]amino]-7-methoxy-3,4-dihydro-2H-chromen-2-yl]benzoic acid.
| Compound Name | 4-[(2R,4R)-4-[[(7S)-2,2-difluoro-7-methyl-6H-furo[2,3-f][1,3]benzodioxole-7-carbonyl]amino]-7-methoxy-3,4-dihydro-2H-chromen-2-yl]benzoic acid |
|---|---|
| PubChem CID | 138596857 |
| Molecular Formula | C28H23F2NO8 |
| Molecular Weight | 539.49 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | 4-[(2R,4R)-4-[[(7S)-2,2-difluoro-7-methyl-6H-furo[2,3-f][1,3]benzodioxole-7-carbonyl]amino]-7-methoxy-3,4-dihydro-2H-chromen-2-yl]benzoic acid |
| SMILES | COc1ccc2c(c1)O[C@@H](c1ccc(C(=O)O)cc1)C[C@H]2NC(=O)[C@]1(C)COc2cc3c(cc21)OC(F)(F)O3 |
| InChI | InChI=1S/C28H23F2NO8/c1-27(13-36-22-12-24-23(10-18(22)27)38-28(29,30)39-24)26(34)31-19-11-20(14-3-5-15(6-4-14)25(32)33)37-21-9-16(35-2)7-8-17(19)21/h3-10,12,19-20H,11,13H2,1-2H3,(H,31,34)(H,32,33)/t19-,20-,27-/m1/s1 |
| InChIKey | UGWNLFKZMZYLFI-SEXOINJZSA-N |
| XLogP | 4.75 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |