C28H24F2N2O6 — CID 140767135
methyl 4-[(2S,4S)-4-[[(7R)-2,2-difluoro-7-methyl-6H-furo[2,3-f][1,3]benzodioxole-7-carbonyl]amino]-1,2,3,4-tetrahydroquinolin-2-yl]benzoate (PubChem CID 140767135) has the molecular formula C28H24F2N2O6 and a molecular weight of 522.50 g/mol. Its IUPAC name is methyl 4-[(2S,4S)-4-[[(7R)-2,2-difluoro-7-methyl-6H-furo[2,3-f][1,3]benzodioxole-7-carbonyl]amino]-1,2,3,4-tetrahydroquinolin-2-yl]benzoate.
| Compound Name | methyl 4-[(2S,4S)-4-[[(7R)-2,2-difluoro-7-methyl-6H-furo[2,3-f][1,3]benzodioxole-7-carbonyl]amino]-1,2,3,4-tetrahydroquinolin-2-yl]benzoate |
|---|---|
| PubChem CID | 140767135 |
| Molecular Formula | C28H24F2N2O6 |
| Molecular Weight | 522.50 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | methyl 4-[(2S,4S)-4-[[(7R)-2,2-difluoro-7-methyl-6H-furo[2,3-f][1,3]benzodioxole-7-carbonyl]amino]-1,2,3,4-tetrahydroquinolin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2C[C@H](NC(=O)[C@@]3(C)COc4cc5c(cc43)OC(F)(F)O5)c3ccccc3N2)cc1 |
| InChI | InChI=1S/C28H24F2N2O6/c1-27(14-36-22-13-24-23(11-18(22)27)37-28(29,30)38-24)26(34)32-21-12-20(31-19-6-4-3-5-17(19)21)15-7-9-16(10-8-15)25(33)35-2/h3-11,13,20-21,31H,12,14H2,1-2H3,(H,32,34)/t20-,21-,27-/m0/s1 |
| InChIKey | WHBFOCQTQHJTLP-IZVMNLJQSA-N |
| XLogP | 4.86 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |