C27H25F2N3O8 — CID 140767098
N-[(2R,4R)-2-[5-[(1S)-1,2-dihydroxyethyl]pyrazin-2-yl]-7-methoxy-3,4-dihydro-2H-chromen-4-yl]-2,2-difluoro-7-methyl-6H-furo[2,3-f][1,3]benzodioxole-7-carboxamide (PubChem CID 140767098) has the molecular formula C27H25F2N3O8 and a molecular weight of 557.51 g/mol. Its IUPAC name is N-[(2R,4R)-2-[5-[(1S)-1,2-dihydroxyethyl]pyrazin-2-yl]-7-methoxy-3,4-dihydro-2H-chromen-4-yl]-2,2-difluoro-7-methyl-6H-furo[2,3-f][1,3]benzodioxole-7-carboxamide.
| Compound Name | N-[(2R,4R)-2-[5-[(1S)-1,2-dihydroxyethyl]pyrazin-2-yl]-7-methoxy-3,4-dihydro-2H-chromen-4-yl]-2,2-difluoro-7-methyl-6H-furo[2,3-f][1,3]benzodioxole-7-carboxamide |
|---|---|
| PubChem CID | 140767098 |
| Molecular Formula | C27H25F2N3O8 |
| Molecular Weight | 557.51 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | N-[(2R,4R)-2-[5-[(1S)-1,2-dihydroxyethyl]pyrazin-2-yl]-7-methoxy-3,4-dihydro-2H-chromen-4-yl]-2,2-difluoro-7-methyl-6H-furo[2,3-f][1,3]benzodioxole-7-carboxamide |
| SMILES | COc1ccc2c(c1)O[C@@H](c1cnc([C@H](O)CO)cn1)C[C@H]2NC(=O)C1(C)COc2cc3c(cc21)OC(F)(F)O3 |
| InChI | InChI=1S/C27H25F2N3O8/c1-26(12-37-21-8-24-23(6-15(21)26)39-27(28,29)40-24)25(35)32-16-7-22(18-10-30-17(9-31-18)19(34)11-33)38-20-5-13(36-2)3-4-14(16)20/h3-6,8-10,16,19,22,33-34H,7,11-12H2,1-2H3,(H,32,35)/t16-,19-,22-,26?/m1/s1 |
| InChIKey | GODUAFVFBRPXRL-RKDUAROYSA-N |
| XLogP | 2.86 |
| TPSA | 141.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |