C22H25NO5 — CID 121302337
methyl 3-[(2R,4R,6S)-4-acetamido-6-(3-methoxyphenyl)oxan-2-yl]benzoate (PubChem CID 121302337) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is methyl 3-[(2R,4R,6S)-4-acetamido-6-(3-methoxyphenyl)oxan-2-yl]benzoate.
| Compound Name | methyl 3-[(2R,4R,6S)-4-acetamido-6-(3-methoxyphenyl)oxan-2-yl]benzoate |
|---|---|
| PubChem CID | 121302337 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | methyl 3-[(2R,4R,6S)-4-acetamido-6-(3-methoxyphenyl)oxan-2-yl]benzoate |
| SMILES | COC(=O)c1cccc([C@H]2C[C@@H](NC(C)=O)C[C@@H](c3cccc(OC)c3)O2)c1 |
| InChI | InChI=1S/C22H25NO5/c1-14(24)23-18-12-20(15-6-4-8-17(10-15)22(25)27-3)28-21(13-18)16-7-5-9-19(11-16)26-2/h4-11,18,20-21H,12-13H2,1-3H3,(H,23,24)/t18-,20-,21+/m1/s1 |
| InChIKey | NTPXHJWSMFKBTL-NRSPTQNISA-N |
| XLogP | 3.58 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |