C30H30N6O2 — CID 121305323
[(3R)-3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-(2-bicyclo[2.2.1]hept-5-enyl)methanone (PubChem CID 121305323) has the molecular formula C30H30N6O2 and a molecular weight of 506.61 g/mol. Its IUPAC name is [(3R)-3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-(2-bicyclo[2.2.1]hept-5-enyl)methanone.
| Compound Name | [(3R)-3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-(2-bicyclo[2.2.1]hept-5-enyl)methanone |
|---|---|
| PubChem CID | 121305323 |
| Molecular Formula | C30H30N6O2 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | [(3R)-3-[4-amino-3-(4-phenoxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-(2-bicyclo[2.2.1]hept-5-enyl)methanone |
| SMILES | Nc1ncnc2c1c(-c1ccc(Oc3ccccc3)cc1)nn2[C@@H]1CCCN(C(=O)C2CC3C=CC2C3)C1 |
| InChI | InChI=1S/C30H30N6O2/c31-28-26-27(20-10-12-24(13-11-20)38-23-6-2-1-3-7-23)34-36(29(26)33-18-32-28)22-5-4-14-35(17-22)30(37)25-16-19-8-9-21(25)15-19/h1-3,6-13,18-19,21-22,25H,4-5,14-17H2,(H2,31,32,33)/t19?,21?,22-,25?/m1/s1 |
| InChIKey | RBBFHSMPRJTUAC-PIYUGUITSA-N |
| XLogP | 5.24 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|