C25H27F6N3O2S — CID 121307703
N-(cyclopropylmethyl)-5-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2-methylphenyl]-4-[(2S)-2-methylpyrrolidine-1-carbonyl]-1,3-thiazole-2-carboxamide (PubChem CID 121307703) has the molecular formula C25H27F6N3O2S and a molecular weight of 547.57 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-5-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2-methylphenyl]-4-[(2S)-2-methylpyrrolidine-1-carbonyl]-1,3-thiazole-2-carboxamide.
| Compound Name | N-(cyclopropylmethyl)-5-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2-methylphenyl]-4-[(2S)-2-methylpyrrolidine-1-carbonyl]-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 121307703 |
| Molecular Formula | C25H27F6N3O2S |
| Molecular Weight | 547.57 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | N-(cyclopropylmethyl)-5-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2-methylphenyl]-4-[(2S)-2-methylpyrrolidine-1-carbonyl]-1,3-thiazole-2-carboxamide |
| SMILES | Cc1cc(C(C)(C(F)(F)F)C(F)(F)F)ccc1-c1sc(C(=O)NCC2CC2)nc1C(=O)N1CCC[C@@H]1C |
| InChI | InChI=1S/C25H27F6N3O2S/c1-13-11-16(23(3,24(26,27)28)25(29,30)31)8-9-17(13)19-18(22(36)34-10-4-5-14(34)2)33-21(37-19)20(35)32-12-15-6-7-15/h8-9,11,14-15H,4-7,10,12H2,1-3H3,(H,32,35)/t14-/m0/s1 |
| InChIKey | PTQZPZBFYITDNS-AWEZNQCLSA-N |
| XLogP | 6.27 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.57 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |