C24H27F6N3O3S — CID 138475289
5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylphenyl]-N-(2-methylpropyl)-4-(2-methylpyrrolidine-1-carbonyl)-1,3-thiazole-2-carboxamide (PubChem CID 138475289) has the molecular formula C24H27F6N3O3S and a molecular weight of 551.55 g/mol. Its IUPAC name is 5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylphenyl]-N-(2-methylpropyl)-4-(2-methylpyrrolidine-1-carbonyl)-1,3-thiazole-2-carboxamide.
| Compound Name | 5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylphenyl]-N-(2-methylpropyl)-4-(2-methylpyrrolidine-1-carbonyl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 138475289 |
| Molecular Formula | C24H27F6N3O3S |
| Molecular Weight | 551.55 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | 5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylphenyl]-N-(2-methylpropyl)-4-(2-methylpyrrolidine-1-carbonyl)-1,3-thiazole-2-carboxamide |
| SMILES | Cc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1-c1sc(C(=O)NCC(C)C)nc1C(=O)N1CCCC1C |
| InChI | InChI=1S/C24H27F6N3O3S/c1-12(2)11-31-19(34)20-32-17(21(35)33-9-5-6-14(33)4)18(37-20)16-8-7-15(10-13(16)3)22(36,23(25,26)27)24(28,29)30/h7-8,10,12,14,36H,5-6,9,11H2,1-4H3,(H,31,34) |
| InChIKey | AHXWWUICXAUJFN-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.55 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |