C25H27F6N3O5S2 — CID 121303242
5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylphenyl]-4-[(2S)-2-methylpyrrolidine-1-carbonyl]-N-(3-methylsulfonylcyclobutyl)-1,3-thiazole-2-carboxamide (PubChem CID 121303242) has the molecular formula C25H27F6N3O5S2 and a molecular weight of 627.63 g/mol. Its IUPAC name is 5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylphenyl]-4-[(2S)-2-methylpyrrolidine-1-carbonyl]-N-(3-methylsulfonylcyclobutyl)-1,3-thiazole-2-carboxamide.
| Compound Name | 5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylphenyl]-4-[(2S)-2-methylpyrrolidine-1-carbonyl]-N-(3-methylsulfonylcyclobutyl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 121303242 |
| Molecular Formula | C25H27F6N3O5S2 |
| Molecular Weight | 627.63 g/mol |
| Exact Mass | 627.13 |
| IUPAC Name | 5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylphenyl]-4-[(2S)-2-methylpyrrolidine-1-carbonyl]-N-(3-methylsulfonylcyclobutyl)-1,3-thiazole-2-carboxamide |
| SMILES | Cc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1-c1sc(C(=O)NC2CC(S(C)(=O)=O)C2)nc1C(=O)N1CCC[C@@H]1C |
| InChI | InChI=1S/C25H27F6N3O5S2/c1-12-9-14(23(37,24(26,27)28)25(29,30)31)6-7-17(12)19-18(22(36)34-8-4-5-13(34)2)33-21(40-19)20(35)32-15-10-16(11-15)41(3,38)39/h6-7,9,13,15-16,37H,4-5,8,10-11H2,1-3H3,(H,32,35)/t13-,15?,16?/m0/s1 |
| InChIKey | FCWIQPVLTYTNDQ-JEYLPNPQSA-N |
| XLogP | 4.36 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.63 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |