C24H22F8N4O3S — CID 138475287
N-cyclobutyl-5-[2-(difluoromethyl)-4-(1,1,1,3,3,3-hexafluoro-2-nitrosopropan-2-yl)phenyl]-4-[(2S)-2-methylpyrrolidine-1-carbonyl]-1,3-thiazole-2-carboxamide (PubChem CID 138475287) has the molecular formula C24H22F8N4O3S and a molecular weight of 598.52 g/mol. Its IUPAC name is N-cyclobutyl-5-[2-(difluoromethyl)-4-(1,1,1,3,3,3-hexafluoro-2-nitrosopropan-2-yl)phenyl]-4-[(2S)-2-methylpyrrolidine-1-carbonyl]-1,3-thiazole-2-carboxamide.
| Compound Name | N-cyclobutyl-5-[2-(difluoromethyl)-4-(1,1,1,3,3,3-hexafluoro-2-nitrosopropan-2-yl)phenyl]-4-[(2S)-2-methylpyrrolidine-1-carbonyl]-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 138475287 |
| Molecular Formula | C24H22F8N4O3S |
| Molecular Weight | 598.52 g/mol |
| Exact Mass | 598.13 |
| IUPAC Name | N-cyclobutyl-5-[2-(difluoromethyl)-4-(1,1,1,3,3,3-hexafluoro-2-nitrosopropan-2-yl)phenyl]-4-[(2S)-2-methylpyrrolidine-1-carbonyl]-1,3-thiazole-2-carboxamide |
| SMILES | C[C@H]1CCCN1C(=O)c1nc(C(=O)NC2CCC2)sc1-c1ccc(C(N=O)(C(F)(F)F)C(F)(F)F)cc1C(F)F |
| InChI | InChI=1S/C24H22F8N4O3S/c1-11-4-3-9-36(11)21(38)16-17(40-20(34-16)19(37)33-13-5-2-6-13)14-8-7-12(10-15(14)18(25)26)22(35-39,23(27,28)29)24(30,31)32/h7-8,10-11,13,18H,2-6,9H2,1H3,(H,33,37)/t11-/m0/s1 |
| InChIKey | MVWQDTYJRLWYRH-NSHDSACASA-N |
| XLogP | 6.74 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.52 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |