C66H86O2S2 — CID 121309422
4,8-bis(2-hexyldecyl)-2-(4-methylphenyl)-6-[4-[5-(5-methylthiophen-2-yl)thiophen-2-yl]phenyl]-s-indacene-1,5-dione (PubChem CID 121309422) has the molecular formula C66H86O2S2 and a molecular weight of 975.55 g/mol. Its IUPAC name is 4,8-bis(2-hexyldecyl)-2-(4-methylphenyl)-6-[4-[5-(5-methylthiophen-2-yl)thiophen-2-yl]phenyl]-s-indacene-1,5-dione.
| Compound Name | 4,8-bis(2-hexyldecyl)-2-(4-methylphenyl)-6-[4-[5-(5-methylthiophen-2-yl)thiophen-2-yl]phenyl]-s-indacene-1,5-dione |
|---|---|
| PubChem CID | 121309422 |
| Molecular Formula | C66H86O2S2 |
| Molecular Weight | 975.55 g/mol |
| Exact Mass | 974.61 |
| IUPAC Name | 4,8-bis(2-hexyldecyl)-2-(4-methylphenyl)-6-[4-[5-(5-methylthiophen-2-yl)thiophen-2-yl]phenyl]-s-indacene-1,5-dione |
| SMILES | CCCCCCCCC(CCCCCC)Cc1c2cc(-c3ccc(-c4ccc(-c5ccc(C)s5)s4)cc3)c(=O)c2c(CC(CCCCCC)CCCCCCCC)c2cc(-c3ccc(C)cc3)c(=O)c12 |
| InChI | InChI=1S/C66H86O2S2/c1-7-11-15-19-21-25-29-49(27-23-17-13-9-3)43-56-58-45-54(51-34-31-47(5)32-35-51)65(67)63(58)57(44-50(28-24-18-14-10-4)30-26-22-20-16-12-8-2)59-46-55(66(68)64(56)59)52-36-38-53(39-37-52)60-41-42-62(70-60)61-40-33-48(6)69-61/h31-42,45-46,49-50H,7-30,43-44H2,1-6H3 |
| InChIKey | KQQLZJUBDVHQIT-UHFFFAOYSA-N |
| XLogP | 20.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 975.55 |
| LogP ≤ 5 | 20.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|