C63H71N3S2 — CID 58500615
2-[5-[2,3-bis(4-ethylphenyl)-8-(5-methylthiophen-2-yl)quinoxalin-5-yl]thiophen-2-yl]-9-heptadecan-9-yl-7-methylcarbazole (PubChem CID 58500615) has the molecular formula C63H71N3S2 and a molecular weight of 934.42 g/mol. Its IUPAC name is 2-[5-[2,3-bis(4-ethylphenyl)-8-(5-methylthiophen-2-yl)quinoxalin-5-yl]thiophen-2-yl]-9-heptadecan-9-yl-7-methylcarbazole.
| Compound Name | 2-[5-[2,3-bis(4-ethylphenyl)-8-(5-methylthiophen-2-yl)quinoxalin-5-yl]thiophen-2-yl]-9-heptadecan-9-yl-7-methylcarbazole |
|---|---|
| PubChem CID | 58500615 |
| Molecular Formula | C63H71N3S2 |
| Molecular Weight | 934.42 g/mol |
| Exact Mass | 933.51 |
| IUPAC Name | 2-[5-[2,3-bis(4-ethylphenyl)-8-(5-methylthiophen-2-yl)quinoxalin-5-yl]thiophen-2-yl]-9-heptadecan-9-yl-7-methylcarbazole |
| SMILES | CCCCCCCCC(CCCCCCCC)n1c2cc(C)ccc2c2ccc(-c3ccc(-c4ccc(-c5ccc(C)s5)c5nc(-c6ccc(CC)cc6)c(-c6ccc(CC)cc6)nc45)s3)cc21 |
| InChI | InChI=1S/C63H71N3S2/c1-7-11-13-15-17-19-21-50(22-20-18-16-14-12-8-2)66-55-41-43(5)23-34-51(55)52-35-33-49(42-56(52)66)57-39-40-59(68-57)54-37-36-53(58-38-24-44(6)67-58)62-63(54)65-61(48-31-27-46(10-4)28-32-48)60(64-62)47-29-25-45(9-3)26-30-47/h23-42,50H,7-22H2,1-6H3 |
| InChIKey | NDLRUFLQKYOFGB-UHFFFAOYSA-N |
| XLogP | 19.98 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 934.42 |
| LogP ≤ 5 | 19.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|