C62H70N2S2Si — CID 58500529
2,3-bis(4-ethylphenyl)-5-[5-(7-methyl-5,5-dioctylbenzo[b][1]benzosilol-3-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)quinoxaline (PubChem CID 58500529) has the molecular formula C62H70N2S2Si and a molecular weight of 935.48 g/mol. Its IUPAC name is 2,3-bis(4-ethylphenyl)-5-[5-(7-methyl-5,5-dioctylbenzo[b][1]benzosilol-3-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)quinoxaline.
| Compound Name | 2,3-bis(4-ethylphenyl)-5-[5-(7-methyl-5,5-dioctylbenzo[b][1]benzosilol-3-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)quinoxaline |
|---|---|
| PubChem CID | 58500529 |
| Molecular Formula | C62H70N2S2Si |
| Molecular Weight | 935.48 g/mol |
| Exact Mass | 934.47 |
| IUPAC Name | 2,3-bis(4-ethylphenyl)-5-[5-(7-methyl-5,5-dioctylbenzo[b][1]benzosilol-3-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)quinoxaline |
| SMILES | CCCCCCCC[Si]1(CCCCCCCC)c2cc(C)ccc2-c2ccc(-c3ccc(-c4ccc(-c5ccc(C)s5)c5nc(-c6ccc(CC)cc6)c(-c6ccc(CC)cc6)nc45)s3)cc21 |
| InChI | InChI=1S/C62H70N2S2Si/c1-7-11-13-15-17-19-39-67(40-20-18-16-14-12-8-2)57-41-43(5)21-32-50(57)51-33-31-49(42-58(51)67)54-37-38-56(66-54)53-35-34-52(55-36-22-44(6)65-55)61-62(53)64-60(48-29-25-46(10-4)26-30-48)59(63-61)47-27-23-45(9-3)24-28-47/h21-38,41-42H,7-20,39-40H2,1-6H3 |
| InChIKey | YDXKMXLKGOTYLD-UHFFFAOYSA-N |
| XLogP | 18.09 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.48 |
| LogP ≤ 5 | 18.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|