C64H74N2S2Si — CID 58500612
5-[5-(7-methyl-5,5-dioctylbenzo[b][1]benzosilol-3-yl)-4-propylthiophen-2-yl]-8-(5-methyl-4-propylthiophen-2-yl)-2,3-diphenylquinoxaline (PubChem CID 58500612) has the molecular formula C64H74N2S2Si and a molecular weight of 963.53 g/mol. Its IUPAC name is 5-[5-(7-methyl-5,5-dioctylbenzo[b][1]benzosilol-3-yl)-4-propylthiophen-2-yl]-8-(5-methyl-4-propylthiophen-2-yl)-2,3-diphenylquinoxaline.
| Compound Name | 5-[5-(7-methyl-5,5-dioctylbenzo[b][1]benzosilol-3-yl)-4-propylthiophen-2-yl]-8-(5-methyl-4-propylthiophen-2-yl)-2,3-diphenylquinoxaline |
|---|---|
| PubChem CID | 58500612 |
| Molecular Formula | C64H74N2S2Si |
| Molecular Weight | 963.53 g/mol |
| Exact Mass | 962.51 |
| IUPAC Name | 5-[5-(7-methyl-5,5-dioctylbenzo[b][1]benzosilol-3-yl)-4-propylthiophen-2-yl]-8-(5-methyl-4-propylthiophen-2-yl)-2,3-diphenylquinoxaline |
| SMILES | CCCCCCCC[Si]1(CCCCCCCC)c2cc(C)ccc2-c2ccc(-c3sc(-c4ccc(-c5cc(CCC)c(C)s5)c5nc(-c6ccccc6)c(-c6ccccc6)nc45)cc3CCC)cc21 |
| InChI | InChI=1S/C64H74N2S2Si/c1-7-11-13-15-17-25-39-69(40-26-18-16-14-12-8-2)58-41-45(5)33-35-52(58)53-36-34-51(44-59(53)69)64-50(28-10-4)43-57(68-64)55-38-37-54(56-42-49(27-9-3)46(6)67-56)62-63(55)66-61(48-31-23-20-24-32-48)60(65-62)47-29-21-19-22-30-47/h19-24,29-38,41-44H,7-18,25-28,39-40H2,1-6H3 |
| InChIKey | DAQPKOGTVZVNPN-UHFFFAOYSA-N |
| XLogP | 18.87 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.53 |
| LogP ≤ 5 | 18.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|