C61H66N2S2 — CID 58500715
5-[5-(9,9-dihexyl-7-methylfluoren-2-yl)-4-propylthiophen-2-yl]-8-(5-methyl-4-propylthiophen-2-yl)-2,3-diphenylquinoxaline (PubChem CID 58500715) has the molecular formula C61H66N2S2 and a molecular weight of 891.35 g/mol. Its IUPAC name is 5-[5-(9,9-dihexyl-7-methylfluoren-2-yl)-4-propylthiophen-2-yl]-8-(5-methyl-4-propylthiophen-2-yl)-2,3-diphenylquinoxaline.
| Compound Name | 5-[5-(9,9-dihexyl-7-methylfluoren-2-yl)-4-propylthiophen-2-yl]-8-(5-methyl-4-propylthiophen-2-yl)-2,3-diphenylquinoxaline |
|---|---|
| PubChem CID | 58500715 |
| Molecular Formula | C61H66N2S2 |
| Molecular Weight | 891.35 g/mol |
| Exact Mass | 890.47 |
| IUPAC Name | 5-[5-(9,9-dihexyl-7-methylfluoren-2-yl)-4-propylthiophen-2-yl]-8-(5-methyl-4-propylthiophen-2-yl)-2,3-diphenylquinoxaline |
| SMILES | CCCCCCC1(CCCCCC)c2cc(C)ccc2-c2ccc(-c3sc(-c4ccc(-c5cc(CCC)c(C)s5)c5nc(-c6ccccc6)c(-c6ccccc6)nc45)cc3CCC)cc21 |
| InChI | InChI=1S/C61H66N2S2/c1-7-11-13-21-35-61(36-22-14-12-8-2)52-37-41(5)29-31-48(52)49-32-30-47(38-53(49)61)60-46(24-10-4)40-55(65-60)51-34-33-50(54-39-45(23-9-3)42(6)64-54)58-59(51)63-57(44-27-19-16-20-28-44)56(62-58)43-25-17-15-18-26-43/h15-20,25-34,37-40H,7-14,21-24,35-36H2,1-6H3 |
| InChIKey | MLUNSTOYDAJAGY-UHFFFAOYSA-N |
| XLogP | 18.82 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.35 |
| LogP ≤ 5 | 18.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|