C26H29FN4O5 — CID 121314563
(3R)-3-[7-[[2-fluoro-5-(2-morpholin-4-ylethoxy)phenyl]methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 121314563) has the molecular formula C26H29FN4O5 and a molecular weight of 496.54 g/mol. Its IUPAC name is (3R)-3-[7-[[2-fluoro-5-(2-morpholin-4-ylethoxy)phenyl]methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | (3R)-3-[7-[[2-fluoro-5-(2-morpholin-4-ylethoxy)phenyl]methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 121314563 |
| Molecular Formula | C26H29FN4O5 |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | (3R)-3-[7-[[2-fluoro-5-(2-morpholin-4-ylethoxy)phenyl]methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CC[C@@H](N2Cc3c(NCc4cc(OCCN5CCOCC5)ccc4F)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H29FN4O5/c27-21-5-4-18(36-13-10-30-8-11-35-12-9-30)14-17(21)15-28-22-3-1-2-19-20(22)16-31(26(19)34)23-6-7-24(32)29-25(23)33/h1-5,14,23,28H,6-13,15-16H2,(H,29,32,33)/t23-/m1/s1 |
| InChIKey | KBBVVYWABYQBFV-HSZRJFAPSA-N |
| XLogP | 1.91 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|