About 2,2-dicyclohexyl-3-propylbutane-1,4-diol
2,2-dicyclohexyl-3-propylbutane-1,4-diol (PubChem CID 121316982) has the molecular formula C19H36O2
and a molecular weight of 296.50 g/mol. Its IUPAC name is 2,2-dicyclohexyl-3-propylbutane-1,4-diol.
Molecular Properties
| Compound Name | 2,2-dicyclohexyl-3-propylbutane-1,4-diol |
| PubChem CID | 121316982 |
| Molecular Formula | C19H36O2 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.27 |
| IUPAC Name | 2,2-dicyclohexyl-3-propylbutane-1,4-diol |
| SMILES | CCCC(CO)C(CO)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C19H36O2/c1-2-9-18(14-20)19(15-21,16-10-5-3-6-11-16)17-12-7-4-8-13-17/h16-18,20-21H,2-15H2,1H3 |
| InChIKey | DAGWMJCEKWTIAQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dicyclohexyl-3-propylbutane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dicyclohexyl-3-propylbutane-1,4-diol?
The IUPAC name of 2,2-dicyclohexyl-3-propylbutane-1,4-diol (CID 121316982) is 2,2-dicyclohexyl-3-propylbutane-1,4-diol.
What is the SMILES notation for 2,2-dicyclohexyl-3-propylbutane-1,4-diol?
The canonical SMILES for 2,2-dicyclohexyl-3-propylbutane-1,4-diol is CCCC(CO)C(CO)(C1CCCCC1)C1CCCCC1.
What is the InChIKey of 2,2-dicyclohexyl-3-propylbutane-1,4-diol?
The InChIKey is DAGWMJCEKWTIAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O2/c1-2-9-18(14-20)19(15-21,16-10-5-3-6-11-16)17-12-7-4-8-13-17/h16-18,20-21H,2-15H2,1H3.
What are the key properties of 2,2-dicyclohexyl-3-propylbutane-1,4-diol?
2,2-dicyclohexyl-3-propylbutane-1,4-diol has a molecular weight of 296.50 g/mol, XLogP of 4.53, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dicyclohexyl-3-propylbutane-1,4-diol is sourced from PubChem (CID 121316982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).