C19H36O2 — CID 121316982
2,2-dicyclohexyl-3-propylbutane-1,4-diol (PubChem CID 121316982) has the molecular formula C19H36O2 and a molecular weight of 296.50 g/mol. Its IUPAC name is 2,2-dicyclohexyl-3-propylbutane-1,4-diol.
| Compound Name | 2,2-dicyclohexyl-3-propylbutane-1,4-diol |
|---|---|
| PubChem CID | 121316982 |
| Molecular Formula | C19H36O2 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.27 |
| IUPAC Name | 2,2-dicyclohexyl-3-propylbutane-1,4-diol |
| SMILES | CCCC(CO)C(CO)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C19H36O2/c1-2-9-18(14-20)19(15-21,16-10-5-3-6-11-16)17-12-7-4-8-13-17/h16-18,20-21H,2-15H2,1H3 |
| InChIKey | DAGWMJCEKWTIAQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |