C15H28O6 — CID 174961698
(5R,6S,7R,8R)-6-cyclohexyl-5,6,7,8,9-pentahydroxynonan-4-one (PubChem CID 174961698) has the molecular formula C15H28O6 and a molecular weight of 304.38 g/mol. Its IUPAC name is (5R,6S,7R,8R)-6-cyclohexyl-5,6,7,8,9-pentahydroxynonan-4-one.
| Compound Name | (5R,6S,7R,8R)-6-cyclohexyl-5,6,7,8,9-pentahydroxynonan-4-one |
|---|---|
| PubChem CID | 174961698 |
| Molecular Formula | C15H28O6 |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | (5R,6S,7R,8R)-6-cyclohexyl-5,6,7,8,9-pentahydroxynonan-4-one |
| SMILES | CCCC(=O)[C@H](O)[C@](O)(C1CCCCC1)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C15H28O6/c1-2-6-11(17)13(19)15(21,14(20)12(18)9-16)10-7-4-3-5-8-10/h10,12-14,16,18-21H,2-9H2,1H3/t12-,13+,14-,15-/m1/s1 |
| InChIKey | DNMJTLFBSGYETA-LXTVHRRPSA-N |
| XLogP | -0.26 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |