C9H17BrO6 — CID 162371310
(5S,6R,7R,8R)-6-bromo-1-deuterio-5,6,7,8,9-pentahydroxynonan-4-one (PubChem CID 162371310) has the molecular formula C9H17BrO6 and a molecular weight of 302.14 g/mol. Its IUPAC name is (5S,6R,7R,8R)-6-bromo-1-deuterio-5,6,7,8,9-pentahydroxynonan-4-one.
| Compound Name | (5S,6R,7R,8R)-6-bromo-1-deuterio-5,6,7,8,9-pentahydroxynonan-4-one |
|---|---|
| PubChem CID | 162371310 |
| Molecular Formula | C9H17BrO6 |
| Molecular Weight | 302.14 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | (5S,6R,7R,8R)-6-bromo-1-deuterio-5,6,7,8,9-pentahydroxynonan-4-one |
| SMILES | [2H]CCCC(=O)[C@H](O)[C@](O)(Br)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H17BrO6/c1-2-3-5(12)7(14)9(10,16)8(15)6(13)4-11/h6-8,11,13-16H,2-4H2,1H3/t6-,7+,8-,9-/m1/s1/i1D |
| InChIKey | MSIXGFHZYBSCJR-PVQHYVPOSA-N |
| XLogP | -1.49 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.14 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|