C9H17BrO6 — CID 175187941
(6R)-6-bromo-5,6,7,8,9-pentahydroxynonan-4-one (PubChem CID 175187941) has the molecular formula C9H17BrO6 and a molecular weight of 301.13 g/mol. Its IUPAC name is (6R)-6-bromo-5,6,7,8,9-pentahydroxynonan-4-one.
| Compound Name | (6R)-6-bromo-5,6,7,8,9-pentahydroxynonan-4-one |
|---|---|
| PubChem CID | 175187941 |
| Molecular Formula | C9H17BrO6 |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | (6R)-6-bromo-5,6,7,8,9-pentahydroxynonan-4-one |
| SMILES | CCCC(=O)C(O)[C@](O)(Br)C(O)C(O)CO |
| InChI | InChI=1S/C9H17BrO6/c1-2-3-5(12)7(14)9(10,16)8(15)6(13)4-11/h6-8,11,13-16H,2-4H2,1H3/t6?,7?,8?,9-/m1/s1 |
| InChIKey | MSIXGFHZYBSCJR-RLKGBJSKSA-N |
| XLogP | -1.49 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|