About 2-methylhexan-3-one;propan-2-ylcyclohexane
2-methylhexan-3-one;propan-2-ylcyclohexane (PubChem CID 166117967) has the molecular formula C16H32O
and a molecular weight of 240.43 g/mol. Its IUPAC name is 2-methylhexan-3-one;propan-2-ylcyclohexane.
Molecular Properties
| Compound Name | 2-methylhexan-3-one;propan-2-ylcyclohexane |
| PubChem CID | 166117967 |
| Molecular Formula | C16H32O |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.25 |
| IUPAC Name | 2-methylhexan-3-one;propan-2-ylcyclohexane |
| SMILES | CC(C)C1CCCCC1.CCCC(=O)C(C)C |
| InChI | InChI=1S/C9H18.C7H14O/c1-8(2)9-6-4-3-5-7-9;1-4-5-7(8)6(2)3/h8-9H,3-7H2,1-2H3;6H,4-5H2,1-3H3 |
| InChIKey | DXLVCQPBLXXULE-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylhexan-3-one;propan-2-ylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhexan-3-one;propan-2-ylcyclohexane?
The IUPAC name of 2-methylhexan-3-one;propan-2-ylcyclohexane (CID 166117967) is 2-methylhexan-3-one;propan-2-ylcyclohexane.
What is the SMILES notation for 2-methylhexan-3-one;propan-2-ylcyclohexane?
The canonical SMILES for 2-methylhexan-3-one;propan-2-ylcyclohexane is CC(C)C1CCCCC1.CCCC(=O)C(C)C.
What is the InChIKey of 2-methylhexan-3-one;propan-2-ylcyclohexane?
The InChIKey is DXLVCQPBLXXULE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18.C7H14O/c1-8(2)9-6-4-3-5-7-9;1-4-5-7(8)6(2)3/h8-9H,3-7H2,1-2H3;6H,4-5H2,1-3H3.
What are the key properties of 2-methylhexan-3-one;propan-2-ylcyclohexane?
2-methylhexan-3-one;propan-2-ylcyclohexane has a molecular weight of 240.43 g/mol, XLogP of 5.23, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhexan-3-one;propan-2-ylcyclohexane is sourced from PubChem (CID 166117967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).