About butanoic acid;1-cyclohexylethyl acetate
butanoic acid;1-cyclohexylethyl acetate (PubChem CID 175401865) has the molecular formula C14H26O4
and a molecular weight of 258.36 g/mol. Its IUPAC name is butanoic acid;1-cyclohexylethyl acetate.
Molecular Properties
| Compound Name | butanoic acid;1-cyclohexylethyl acetate |
| PubChem CID | 175401865 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | butanoic acid;1-cyclohexylethyl acetate |
| SMILES | CC(=O)OC(C)C1CCCCC1.CCCC(=O)O |
| InChI | InChI=1S/C10H18O2.C4H8O2/c1-8(12-9(2)11)10-6-4-3-5-7-10;1-2-3-4(5)6/h8,10H,3-7H2,1-2H3;2-3H2,1H3,(H,5,6) |
| InChIKey | PRWMDCKNZPYRPK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze butanoic acid;1-cyclohexylethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoic acid;1-cyclohexylethyl acetate?
The IUPAC name of butanoic acid;1-cyclohexylethyl acetate (CID 175401865) is butanoic acid;1-cyclohexylethyl acetate.
What is the SMILES notation for butanoic acid;1-cyclohexylethyl acetate?
The canonical SMILES for butanoic acid;1-cyclohexylethyl acetate is CC(=O)OC(C)C1CCCCC1.CCCC(=O)O.
What is the InChIKey of butanoic acid;1-cyclohexylethyl acetate?
The InChIKey is PRWMDCKNZPYRPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2.C4H8O2/c1-8(12-9(2)11)10-6-4-3-5-7-10;1-2-3-4(5)6/h8,10H,3-7H2,1-2H3;2-3H2,1H3,(H,5,6).
What are the key properties of butanoic acid;1-cyclohexylethyl acetate?
butanoic acid;1-cyclohexylethyl acetate has a molecular weight of 258.36 g/mol, XLogP of 3.39, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butanoic acid;1-cyclohexylethyl acetate is sourced from PubChem (CID 175401865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).