About 3-cyclohexyl-2,5-dimethylnonan-3-ol
3-cyclohexyl-2,5-dimethylnonan-3-ol (PubChem CID 170160777) has the molecular formula C17H34O
and a molecular weight of 254.46 g/mol. Its IUPAC name is 3-cyclohexyl-2,5-dimethylnonan-3-ol.
Molecular Properties
| Compound Name | 3-cyclohexyl-2,5-dimethylnonan-3-ol |
| PubChem CID | 170160777 |
| Molecular Formula | C17H34O |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.26 |
| IUPAC Name | 3-cyclohexyl-2,5-dimethylnonan-3-ol |
| SMILES | CCCCC(C)CC(O)(C(C)C)C1CCCCC1 |
| InChI | InChI=1S/C17H34O/c1-5-6-10-15(4)13-17(18,14(2)3)16-11-8-7-9-12-16/h14-16,18H,5-13H2,1-4H3 |
| InChIKey | IVMQSGOSHMAQIA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-cyclohexyl-2,5-dimethylnonan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-2,5-dimethylnonan-3-ol?
The IUPAC name of 3-cyclohexyl-2,5-dimethylnonan-3-ol (CID 170160777) is 3-cyclohexyl-2,5-dimethylnonan-3-ol.
What is the SMILES notation for 3-cyclohexyl-2,5-dimethylnonan-3-ol?
The canonical SMILES for 3-cyclohexyl-2,5-dimethylnonan-3-ol is CCCCC(C)CC(O)(C(C)C)C1CCCCC1.
What is the InChIKey of 3-cyclohexyl-2,5-dimethylnonan-3-ol?
The InChIKey is IVMQSGOSHMAQIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O/c1-5-6-10-15(4)13-17(18,14(2)3)16-11-8-7-9-12-16/h14-16,18H,5-13H2,1-4H3.
What are the key properties of 3-cyclohexyl-2,5-dimethylnonan-3-ol?
3-cyclohexyl-2,5-dimethylnonan-3-ol has a molecular weight of 254.46 g/mol, XLogP of 5.17, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-2,5-dimethylnonan-3-ol is sourced from PubChem (CID 170160777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).