C32H38N2O5S — CID 121324432
[(Z)-(1-benzo[g][1,3]benzoxazol-2-yl-3,3-dimethyl-2-oxobutylidene)amino] 2,4,6-tri(propan-2-yl)benzenesulfonate (PubChem CID 121324432) has the molecular formula C32H38N2O5S and a molecular weight of 562.73 g/mol. Its IUPAC name is [(Z)-(1-benzo[g][1,3]benzoxazol-2-yl-3,3-dimethyl-2-oxobutylidene)amino] 2,4,6-tri(propan-2-yl)benzenesulfonate.
| Compound Name | [(Z)-(1-benzo[g][1,3]benzoxazol-2-yl-3,3-dimethyl-2-oxobutylidene)amino] 2,4,6-tri(propan-2-yl)benzenesulfonate |
|---|---|
| PubChem CID | 121324432 |
| Molecular Formula | C32H38N2O5S |
| Molecular Weight | 562.73 g/mol |
| Exact Mass | 562.25 |
| IUPAC Name | [(Z)-(1-benzo[g][1,3]benzoxazol-2-yl-3,3-dimethyl-2-oxobutylidene)amino] 2,4,6-tri(propan-2-yl)benzenesulfonate |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)O/N=C(\C(=O)C(C)(C)C)c2nc3ccc4ccccc4c3o2)c(C(C)C)c1 |
| InChI | InChI=1S/C32H38N2O5S/c1-18(2)22-16-24(19(3)4)29(25(17-22)20(5)6)40(36,37)39-34-27(30(35)32(7,8)9)31-33-26-15-14-21-12-10-11-13-23(21)28(26)38-31/h10-20H,1-9H3/b34-27+ |
| InChIKey | UUGKPLIUAKZZTP-DNGXXSEMSA-N |
| XLogP | 8.08 |
| TPSA | 98.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.73 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|