C17H21F3N4O2S — CID 121326760
1-methylsulfonyl-4-[6-(trifluoromethyl)-1H-indazol-4-yl]-2,3,4a,5,6,7,8,8a-octahydroquinoxaline (PubChem CID 121326760) has the molecular formula C17H21F3N4O2S and a molecular weight of 402.44 g/mol. Its IUPAC name is 1-methylsulfonyl-4-[6-(trifluoromethyl)-1H-indazol-4-yl]-2,3,4a,5,6,7,8,8a-octahydroquinoxaline.
| Compound Name | 1-methylsulfonyl-4-[6-(trifluoromethyl)-1H-indazol-4-yl]-2,3,4a,5,6,7,8,8a-octahydroquinoxaline |
|---|---|
| PubChem CID | 121326760 |
| Molecular Formula | C17H21F3N4O2S |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 1-methylsulfonyl-4-[6-(trifluoromethyl)-1H-indazol-4-yl]-2,3,4a,5,6,7,8,8a-octahydroquinoxaline |
| SMILES | CS(=O)(=O)N1CCN(c2cc(C(F)(F)F)cc3[nH]ncc23)C2CCCCC21 |
| InChI | InChI=1S/C17H21F3N4O2S/c1-27(25,26)24-7-6-23(14-4-2-3-5-15(14)24)16-9-11(17(18,19)20)8-13-12(16)10-21-22-13/h8-10,14-15H,2-7H2,1H3,(H,21,22) |
| InChIKey | LYULDLGYGRIIMN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |