C8H8I2N4 — CID 121327737
(Z)-3-N-(2-iminoethylidene)-4-iodo-1-N-[(Z)-2-iodoethenyl]but-3-ene-1,2,3-triimine (PubChem CID 121327737) has the molecular formula C8H8I2N4 and a molecular weight of 413.99 g/mol. Its IUPAC name is (Z)-3-N-(2-iminoethylidene)-4-iodo-1-N-[(Z)-2-iodoethenyl]but-3-ene-1,2,3-triimine.
| Compound Name | (Z)-3-N-(2-iminoethylidene)-4-iodo-1-N-[(Z)-2-iodoethenyl]but-3-ene-1,2,3-triimine |
|---|---|
| PubChem CID | 121327737 |
| Molecular Formula | C8H8I2N4 |
| Molecular Weight | 413.99 g/mol |
| Exact Mass | 413.88 |
| IUPAC Name | (Z)-3-N-(2-iminoethylidene)-4-iodo-1-N-[(Z)-2-iodoethenyl]but-3-ene-1,2,3-triimine |
| SMILES | [H]/N=C(\C=N\C=C/I)C(=C/I)/N=C/C=N/[H] |
| InChI | InChI=1S/C8H8I2N4/c9-1-3-13-6-7(12)8(5-10)14-4-2-11/h1-6,11-12H/b3-1-,8-5-,11-2+,12-7+,13-6+,14-4+ |
| InChIKey | BCRPUNOORROALD-UEYQWDPZSA-N |
| XLogP | 2.98 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.99 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|