C8H13IN2 — CID 89029602
1-N-[(Z)-2-iodoethenyl]-3,3-dimethylbutane-1,2-diimine (PubChem CID 89029602) has the molecular formula C8H13IN2 and a molecular weight of 264.11 g/mol. Its IUPAC name is 1-N-[(Z)-2-iodoethenyl]-3,3-dimethylbutane-1,2-diimine.
| Compound Name | 1-N-[(Z)-2-iodoethenyl]-3,3-dimethylbutane-1,2-diimine |
|---|---|
| PubChem CID | 89029602 |
| Molecular Formula | C8H13IN2 |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | 1-N-[(Z)-2-iodoethenyl]-3,3-dimethylbutane-1,2-diimine |
| SMILES | [H]/N=C(\C=N\C=C/I)C(C)(C)C |
| InChI | InChI=1S/C8H13IN2/c1-8(2,3)7(10)6-11-5-4-9/h4-6,10H,1-3H3/b5-4-,10-7+,11-6+ |
| InChIKey | VPIDAVOQDPICKF-AEILHZCFSA-N |
| XLogP | 3.03 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|